C26H32ClF3N6O2S — CID 85469828
3-N-[3-chloro-4-[4-[1-(3,3-dimethylbutyl)piperidin-3-yl]sulfonylphenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 85469828) has the molecular formula C26H32ClF3N6O2S and a molecular weight of 585.10 g/mol. Its IUPAC name is 3-N-[3-chloro-4-[4-[1-(3,3-dimethylbutyl)piperidin-3-yl]sulfonylphenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-4-[4-[1-(3,3-dimethylbutyl)piperidin-3-yl]sulfonylphenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 85469828 |
| Molecular Formula | C26H32ClF3N6O2S |
| Molecular Weight | 585.10 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 3-N-[3-chloro-4-[4-[1-(3,3-dimethylbutyl)piperidin-3-yl]sulfonylphenyl]-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)(C)CCN1CCCC(S(=O)(=O)c2ccc(-c3c(Cl)cc(Nc4n[nH]c(N)n4)cc3C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C26H32ClF3N6O2S/c1-25(2,3)10-12-36-11-4-5-19(15-36)39(37,38)18-8-6-16(7-9-18)22-20(26(28,29)30)13-17(14-21(22)27)32-24-33-23(31)34-35-24/h6-9,13-14,19H,4-5,10-12,15H2,1-3H3,(H4,31,32,33,34,35) |
| InChIKey | NXRRTSHFIHGMOW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.10 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |