C11H20N2O5 — CID 85469841
(2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) propanoate (PubChem CID 85469841) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) propanoate.
| Compound Name | (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) propanoate |
|---|---|
| PubChem CID | 85469841 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2,2,5,5-tetramethyl-3-nitrooxypyrrolidin-1-yl) propanoate |
| SMILES | CCC(=O)ON1C(C)(C)CC(O[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C11H20N2O5/c1-6-9(14)18-12-10(2,3)7-8(11(12,4)5)17-13(15)16/h8H,6-7H2,1-5H3 |
| InChIKey | FGGRQARKHIGBRT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|