C10H17N3O8 — CID 85469843
(2,2,5,5-tetramethyl-3,4-dinitrooxypyrrolidin-1-yl) acetate (PubChem CID 85469843) has the molecular formula C10H17N3O8 and a molecular weight of 307.26 g/mol. Its IUPAC name is (2,2,5,5-tetramethyl-3,4-dinitrooxypyrrolidin-1-yl) acetate.
| Compound Name | (2,2,5,5-tetramethyl-3,4-dinitrooxypyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 85469843 |
| Molecular Formula | C10H17N3O8 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2,2,5,5-tetramethyl-3,4-dinitrooxypyrrolidin-1-yl) acetate |
| SMILES | CC(=O)ON1C(C)(C)C(O[N+](=O)[O-])C(O[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C10H17N3O8/c1-6(14)19-11-9(2,3)7(20-12(15)16)8(10(11,4)5)21-13(17)18/h7-8H,1-5H3 |
| InChIKey | SFEVDXRZZUPLOP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|