C14H13BrClN3O — CID 85470187
1-(6-bromo-3-pyridinyl)-3-(3-chlorophenyl)-1,3-dimethylurea (PubChem CID 85470187) has the molecular formula C14H13BrClN3O and a molecular weight of 354.64 g/mol. Its IUPAC name is 1-(6-bromo-3-pyridinyl)-3-(3-chlorophenyl)-1,3-dimethylurea.
| Compound Name | 1-(6-bromo-3-pyridinyl)-3-(3-chlorophenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 85470187 |
| Molecular Formula | C14H13BrClN3O |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 1-(6-bromo-3-pyridinyl)-3-(3-chlorophenyl)-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)c1cccc(Cl)c1)c1ccc(Br)nc1 |
| InChI | InChI=1S/C14H13BrClN3O/c1-18(11-5-3-4-10(16)8-11)14(20)19(2)12-6-7-13(15)17-9-12/h3-9H,1-2H3 |
| InChIKey | LOKOTYANSNLZTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|