About ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate
ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate (PubChem CID 85470605) has the molecular formula C19H18ClNO4
and a molecular weight of 359.81 g/mol. Its IUPAC name is ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate.
Molecular Properties
| Compound Name | ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate |
| PubChem CID | 85470605 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate |
| SMILES | CCOC(=O)C(=O)CC(=O)/C=C/c1cccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNO4/c1-2-25-19(24)18(23)12-16(22)10-9-15-7-5-11-21(15)13-14-6-3-4-8-17(14)20/h3-11H,2,12-13H2,1H3/b10-9+ |
| InChIKey | BPIOFONJRYTCQB-MDZDMXLPSA-N |
| XLogP | 3.29 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate?
The IUPAC name of ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate (CID 85470605) is ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate.
What is the SMILES notation for ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate?
The canonical SMILES for ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate is CCOC(=O)C(=O)CC(=O)/C=C/c1cccn1Cc1ccccc1Cl.
What is the InChIKey of ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate?
The InChIKey is BPIOFONJRYTCQB-MDZDMXLPSA-N. The full InChI is InChI=1S/C19H18ClNO4/c1-2-25-19(24)18(23)12-16(22)10-9-15-7-5-11-21(15)13-14-6-3-4-8-17(14)20/h3-11H,2,12-13H2,1H3/b10-9+.
What are the key properties of ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate?
ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate has a molecular weight of 359.81 g/mol, XLogP of 3.29, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-6-[1-[(2-chlorophenyl)methyl]pyrrol-2-yl]-2,4-dioxohex-5-enoate is sourced from PubChem (CID 85470605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).