About (E,2S)-hept-5-en-3-yn-2-ol
(E,2S)-hept-5-en-3-yn-2-ol (PubChem CID 85470640) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is (E,2S)-hept-5-en-3-yn-2-ol.
Molecular Properties
| Compound Name | (E,2S)-hept-5-en-3-yn-2-ol |
| PubChem CID | 85470640 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (E,2S)-hept-5-en-3-yn-2-ol |
| SMILES | C/C=C/C#C[C@H](C)O |
| InChI | InChI=1S/C7H10O/c1-3-4-5-6-7(2)8/h3-4,7-8H,1-2H3/b4-3+/t7-/m0/s1 |
| InChIKey | RKGMKMBCTMJQBR-SDLBARTOSA-N |
| XLogP | 0.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-hept-5-en-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-hept-5-en-3-yn-2-ol?
The IUPAC name of (E,2S)-hept-5-en-3-yn-2-ol (CID 85470640) is (E,2S)-hept-5-en-3-yn-2-ol.
What is the SMILES notation for (E,2S)-hept-5-en-3-yn-2-ol?
The canonical SMILES for (E,2S)-hept-5-en-3-yn-2-ol is C/C=C/C#C[C@H](C)O.
What is the InChIKey of (E,2S)-hept-5-en-3-yn-2-ol?
The InChIKey is RKGMKMBCTMJQBR-SDLBARTOSA-N. The full InChI is InChI=1S/C7H10O/c1-3-4-5-6-7(2)8/h3-4,7-8H,1-2H3/b4-3+/t7-/m0/s1.
What are the key properties of (E,2S)-hept-5-en-3-yn-2-ol?
(E,2S)-hept-5-en-3-yn-2-ol has a molecular weight of 110.16 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-hept-5-en-3-yn-2-ol is sourced from PubChem (CID 85470640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).