C22H33BFNO4 — CID 85470658
tert-butyl (3R,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate (PubChem CID 85470658) has the molecular formula C22H33BFNO4 and a molecular weight of 405.32 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 85470658 |
| Molecular Formula | C22H33BFNO4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl (3R,4S)-4-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccc(F)cc2)[C@@H](B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C22H33BFNO4/c1-20(2,3)27-19(26)25-13-12-17(15-8-10-16(24)11-9-15)18(14-25)23-28-21(4,5)22(6,7)29-23/h8-11,17-18H,12-14H2,1-7H3/t17-,18+/m1/s1 |
| InChIKey | LLEYHLNNORGNOF-MSOLQXFVSA-N |
| XLogP | 5.01 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|