About (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran
(6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran (PubChem CID 85470660) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran |
| PubChem CID | 85470660 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran |
| SMILES | C1=C[C@H](c2ccc3ccccc3c2)OCC1 |
| InChI | InChI=1S/C15H14O/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15/h1-3,5-9,11,15H,4,10H2/t15-/m1/s1 |
| InChIKey | JYKXAJFSPMDKDK-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran?
The IUPAC name of (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran (CID 85470660) is (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran?
The canonical SMILES for (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran is C1=C[C@H](c2ccc3ccccc3c2)OCC1.
What is the InChIKey of (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran?
The InChIKey is JYKXAJFSPMDKDK-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H14O/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15/h1-3,5-9,11,15H,4,10H2/t15-/m1/s1.
What are the key properties of (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran?
(6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran has a molecular weight of 210.28 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-naphthalen-2-yl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 85470660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).