C17H20F3NO2 — CID 85470684
tert-butyl (6S)-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 85470684) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is tert-butyl (6S)-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (6S)-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 85470684 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | tert-butyl (6S)-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3NO2/c1-16(2,3)23-15(22)21-11-5-4-6-14(21)12-7-9-13(10-8-12)17(18,19)20/h4,6-10,14H,5,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | DSMZFMGSDYIGAH-AWEZNQCLSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|