C31H34F6N4O2S — CID 85471475
(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[cyclohexyl(ethyl)amino]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 85471475) has the molecular formula C31H34F6N4O2S and a molecular weight of 640.69 g/mol. Its IUPAC name is (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[cyclohexyl(ethyl)amino]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[cyclohexyl(ethyl)amino]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 85471475 |
| Molecular Formula | C31H34F6N4O2S |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[cyclohexyl(ethyl)amino]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-3-pyridinyl]methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CCN(c1ncc(-c2sc(C)nc2C)cc1CN1C(=O)O[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]1C)C1CCCCC1 |
| InChI | InChI=1S/C31H34F6N4O2S/c1-5-40(25-9-7-6-8-10-25)28-22(11-21(15-38-28)27-17(2)39-19(4)44-27)16-41-18(3)26(43-29(41)42)20-12-23(30(32,33)34)14-24(13-20)31(35,36)37/h11-15,18,25-26H,5-10,16H2,1-4H3/t18-,26-/m0/s1 |
| InChIKey | UNQXPRIGVJDTOE-QYBDOPJKSA-N |
| XLogP | 9.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |