About 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol
1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol (PubChem CID 85471641) has the molecular formula C21H29N5O4
and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol |
| PubChem CID | 85471641 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol |
| SMILES | NCC(O)COc1cccc(-c2nc(N3CCOCC3)cc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C21H29N5O4/c22-14-17(27)15-30-18-3-1-2-16(12-18)21-23-19(25-4-8-28-9-5-25)13-20(24-21)26-6-10-29-11-7-26/h1-3,12-13,17,27H,4-11,14-15,22H2 |
| InChIKey | WCDJOTJGARTPNE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol?
The IUPAC name of 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol (CID 85471641) is 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol.
What is the SMILES notation for 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol?
The canonical SMILES for 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol is NCC(O)COc1cccc(-c2nc(N3CCOCC3)cc(N3CCOCC3)n2)c1.
What is the InChIKey of 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol?
The InChIKey is WCDJOTJGARTPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N5O4/c22-14-17(27)15-30-18-3-1-2-16(12-18)21-23-19(25-4-8-28-9-5-25)13-20(24-21)26-6-10-29-11-7-26/h1-3,12-13,17,27H,4-11,14-15,22H2.
What are the key properties of 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol?
1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol has a molecular weight of 415.49 g/mol, XLogP of 0.52, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[3-(4,6-dimorpholin-4-ylpyrimidin-2-yl)phenoxy]propan-2-ol is sourced from PubChem (CID 85471641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).