C25H16ClF10N3O3 — CID 85471992
N-[3-[[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-N-ethylpyridine-4-carboxamide (PubChem CID 85471992) has the molecular formula C25H16ClF10N3O3 and a molecular weight of 631.85 g/mol. Its IUPAC name is N-[3-[[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-N-ethylpyridine-4-carboxamide.
| Compound Name | N-[3-[[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-N-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 85471992 |
| Molecular Formula | C25H16ClF10N3O3 |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.07 |
| IUPAC Name | N-[3-[[2-chloro-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]-N-ethylpyridine-4-carboxamide |
| SMILES | CCN(C(=O)c1ccncc1)c1cccc(C(=O)Nc2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1F |
| InChI | InChI=1S/C25H16ClF10N3O3/c1-2-39(21(41)12-6-8-37-9-7-12)16-5-3-4-14(18(16)27)20(40)38-19-15(26)10-13(11-17(19)42-22(28)29)23(30,24(31,32)33)25(34,35)36/h3-11,22H,2H2,1H3,(H,38,40) |
| InChIKey | QHTHLDFDYCVWGZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |