C20H18ClFN6O2 — CID 85472187
N-[3-[6-(3-aminopropylamino)-1H-imidazo[4,5-b]pyridin-2-yl]-4-chlorophenyl]-5-fluorofuran-2-carboxamide (PubChem CID 85472187) has the molecular formula C20H18ClFN6O2 and a molecular weight of 428.86 g/mol. Its IUPAC name is N-[3-[6-(3-aminopropylamino)-1H-imidazo[4,5-b]pyridin-2-yl]-4-chlorophenyl]-5-fluorofuran-2-carboxamide.
| Compound Name | N-[3-[6-(3-aminopropylamino)-1H-imidazo[4,5-b]pyridin-2-yl]-4-chlorophenyl]-5-fluorofuran-2-carboxamide |
|---|---|
| PubChem CID | 85472187 |
| Molecular Formula | C20H18ClFN6O2 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[3-[6-(3-aminopropylamino)-1H-imidazo[4,5-b]pyridin-2-yl]-4-chlorophenyl]-5-fluorofuran-2-carboxamide |
| SMILES | NCCCNc1cnc2nc(-c3cc(NC(=O)c4ccc(F)o4)ccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C20H18ClFN6O2/c21-14-3-2-11(26-20(29)16-4-5-17(22)30-16)8-13(14)18-27-15-9-12(24-7-1-6-23)10-25-19(15)28-18/h2-5,8-10,24H,1,6-7,23H2,(H,26,29)(H,25,27,28) |
| InChIKey | UKPBAFBEOUVWHG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|