C23H26Cl3N5 — CID 85472274
4-naphthalen-2-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472274) has the molecular formula C23H26Cl3N5 and a molecular weight of 478.86 g/mol. Its IUPAC name is 4-naphthalen-2-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-naphthalen-2-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472274 |
| Molecular Formula | C23H26Cl3N5 |
| Molecular Weight | 478.86 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 4-naphthalen-2-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)N1CCC(CNc2nc(-c3ccc4ccccc4c3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C23H26Cl3N5/c1-15(2)31-11-9-16(10-12-31)14-27-22-29-20(28-21(30-22)23(24,25)26)19-8-7-17-5-3-4-6-18(17)13-19/h3-8,13,15-16H,9-12,14H2,1-2H3,(H,27,28,29,30) |
| InChIKey | IYCSRGPVVXEVKG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.86 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|