About US10633389, Example 51-1
US10633389, Example 51-1 (PubChem CID 85472559) has the molecular formula C26H36N6O3
and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-(methylamino)-3-[3-[4-[1-(2-methylpropyl)pyrazol-4-yl]-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]propan-2-ol.
Molecular Properties
| Compound Name | US10633389, Example 51-1 |
| PubChem CID | 85472559 |
| Molecular Formula | C26H36N6O3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 1-(methylamino)-3-[3-[4-[1-(2-methylpropyl)pyrazol-4-yl]-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)CN1C=C(C=N1)C2=CC(=NC(=N2)C3=CC(=CC=C3)OCC(CNC)O)NC4CCOCC4 |
| InChI | InChI=1S/C26H36N6O3/c1-18(2)15-32-16-20(13-28-32)24-12-25(29-21-7-9-34-10-8-21)31-26(30-24)19-5-4-6-23(11-19)35-17-22(33)14-27-3/h4-6,11-13,16,18,21-22,27,33H,7-10,14-15,17H2,1-3H3,(H,29,30,31) |
| InChIKey | WTLFIMWRRICGHY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | 608 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze US10633389, Example 51-1 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10633389, Example 51-1?
The IUPAC name of US10633389, Example 51-1 (CID 85472559) is 1-(methylamino)-3-[3-[4-[1-(2-methylpropyl)pyrazol-4-yl]-6-(oxan-4-ylamino)pyrimidin-2-yl]phenoxy]propan-2-ol.
What is the SMILES notation for US10633389, Example 51-1?
The canonical SMILES for US10633389, Example 51-1 is CC(C)CN1C=C(C=N1)C2=CC(=NC(=N2)C3=CC(=CC=C3)OCC(CNC)O)NC4CCOCC4.
What is the InChIKey of US10633389, Example 51-1?
The InChIKey is WTLFIMWRRICGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N6O3/c1-18(2)15-32-16-20(13-28-32)24-12-25(29-21-7-9-34-10-8-21)31-26(30-24)19-5-4-6-23(11-19)35-17-22(33)14-27-3/h4-6,11-13,16,18,21-22,27,33H,7-10,14-15,17H2,1-3H3,(H,29,30,31).
What are the key properties of US10633389, Example 51-1?
US10633389, Example 51-1 has a molecular weight of 480.60 g/mol, XLogP of 2.70, 11 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for US10633389, Example 51-1 is sourced from PubChem (CID 85472559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).