C17H21N3OS — CID 85472605
N-(5-cyano-1,3-thiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 85472605) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 85472605 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)Nc1ncc(C#N)s1)(C3)C2 |
| InChI | InChI=1S/C17H21N3OS/c1-15-3-11-4-16(2,8-15)10-17(5-11,9-15)13(21)20-14-19-7-12(6-18)22-14/h7,11H,3-5,8-10H2,1-2H3,(H,19,20,21) |
| InChIKey | JIWMMVJKFIJPNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |