C18H22Cl3N5O2 — CID 85472782
4-(3,4-dimethoxyphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85472782) has the molecular formula C18H22Cl3N5O2 and a molecular weight of 446.77 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85472782 |
| Molecular Formula | C18H22Cl3N5O2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(2-pyrrolidin-1-ylethyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(-c2nc(NCCN3CCCC3)nc(C(Cl)(Cl)Cl)n2)cc1OC |
| InChI | InChI=1S/C18H22Cl3N5O2/c1-27-13-6-5-12(11-14(13)28-2)15-23-16(18(19,20)21)25-17(24-15)22-7-10-26-8-3-4-9-26/h5-6,11H,3-4,7-10H2,1-2H3,(H,22,23,24,25) |
| InChIKey | AUILSWKBCVAEDD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|