C16H26O5 — CID 85472854
(1R,2R,2'R,3aS,4R,5S,7aS)-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-1,4,5-triol (PubChem CID 85472854) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1R,2R,2'R,3aS,4R,5S,7aS)-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-1,4,5-triol.
| Compound Name | (1R,2R,2'R,3aS,4R,5S,7aS)-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-1,4,5-triol |
|---|---|
| PubChem CID | 85472854 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (1R,2R,2'R,3aS,4R,5S,7aS)-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-1,4,5-triol |
| SMILES | C=C1CO[C@@H](OC)[C@]12C[C@@H]1[C@@H](O)[C@@H](O)CC(C)[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C16H26O5/c1-8-5-11(17)12(18)10-6-16(13(19)15(8,10)3)9(2)7-21-14(16)20-4/h8,10-14,17-19H,2,5-7H2,1,3-4H3/t8?,10-,11+,12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | IGDWQEANKHRJCK-WPBAQBQFSA-N |
| XLogP | 0.68 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|