C22H13ClFN5O2 — CID 85472996
N-[4-chloro-3-[6-(2-fluoro-4-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]furan-2-carboxamide (PubChem CID 85472996) has the molecular formula C22H13ClFN5O2 and a molecular weight of 433.83 g/mol. Its IUPAC name is N-[4-chloro-3-[6-(2-fluoro-4-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-chloro-3-[6-(2-fluoro-4-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 85472996 |
| Molecular Formula | C22H13ClFN5O2 |
| Molecular Weight | 433.83 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[4-chloro-3-[6-(2-fluoro-4-pyridinyl)-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ncc(-c4ccnc(F)c4)cc3[nH]2)c1)c1ccco1 |
| InChI | InChI=1S/C22H13ClFN5O2/c23-16-4-3-14(27-22(30)18-2-1-7-31-18)10-15(16)20-28-17-8-13(11-26-21(17)29-20)12-5-6-25-19(24)9-12/h1-11H,(H,27,30)(H,26,28,29) |
| InChIKey | XKTJTRBHYCAJMJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|