C30H24F5N5O4 — CID 85473091
5-[4-fluoro-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 85473091) has the molecular formula C30H24F5N5O4 and a molecular weight of 613.54 g/mol. Its IUPAC name is 5-[4-fluoro-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-[4-fluoro-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 85473091 |
| Molecular Formula | C30H24F5N5O4 |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 5-[4-fluoro-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3ccc(F)c(C(=O)NC(C)(C)c4ncon4)c3)cc12 |
| InChI | InChI=1S/C30H24F5N5O4/c1-29(2,28-37-14-43-40-28)39-25(41)19-12-16(6-9-21(19)32)18-13-20-23(26(42)36-3)24(15-4-7-17(31)8-5-15)44-27(20)38-22(18)10-11-30(33,34)35/h4-9,12-14H,10-11H2,1-3H3,(H,36,42)(H,39,41) |
| InChIKey | XXKZLVTVYCBMNP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |