C23H27ClO6 — CID 85473139
(2S,3R,4R,5S,6R)-2-[5-chloro-6-[(4-methylphenyl)methyl]-3,4-dihydro-2H-chromen-8-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85473139) has the molecular formula C23H27ClO6 and a molecular weight of 434.92 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-chloro-6-[(4-methylphenyl)methyl]-3,4-dihydro-2H-chromen-8-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-chloro-6-[(4-methylphenyl)methyl]-3,4-dihydro-2H-chromen-8-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85473139 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-chloro-6-[(4-methylphenyl)methyl]-3,4-dihydro-2H-chromen-8-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2Cl)CCCO3)cc1 |
| InChI | InChI=1S/C23H27ClO6/c1-12-4-6-13(7-5-12)9-14-10-16(22-15(18(14)24)3-2-8-29-22)23-21(28)20(27)19(26)17(11-25)30-23/h4-7,10,17,19-21,23,25-28H,2-3,8-9,11H2,1H3/t17-,19-,20+,21-,23+/m1/s1 |
| InChIKey | GVYSTCOUZLXZES-SQKWCZRTSA-N |
| XLogP | 2.08 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |