C25H33N5O4 — CID 85473188
1-[3-[4-[[(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]amino]-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-(methylamino)propan-2-ol (PubChem CID 85473188) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[3-[4-[[(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]amino]-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-(methylamino)propan-2-ol.
| Compound Name | 1-[3-[4-[[(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]amino]-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 85473188 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[3-[4-[[(3aR,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]amino]-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenoxy]-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)COc1cccc(-c2cc(N[C@H]3CO[C@@H]4OCC[C@@H]43)c3cnn(C(C)C)c3n2)c1 |
| InChI | InChI=1S/C25H33N5O4/c1-15(2)30-24-20(12-27-30)22(28-23-14-34-25-19(23)7-8-32-25)10-21(29-24)16-5-4-6-18(9-16)33-13-17(31)11-26-3/h4-6,9-10,12,15,17,19,23,25-26,31H,7-8,11,13-14H2,1-3H3,(H,28,29)/t17?,19-,23+,25+/m1/s1 |
| InChIKey | IFWLAOURQPBAJV-FSSGDRSQSA-N |
| XLogP | 2.81 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |