C31H27F4N5O5 — CID 85473215
2-(4-fluorophenyl)-5-[4-methoxy-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 85473215) has the molecular formula C31H27F4N5O5 and a molecular weight of 625.58 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[4-methoxy-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[4-methoxy-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 85473215 |
| Molecular Formula | C31H27F4N5O5 |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[4-methoxy-3-[2-(1,2,4-oxadiazol-3-yl)propan-2-ylcarbamoyl]phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3ccc(OC)c(C(=O)NC(C)(C)c4ncon4)c3)cc12 |
| InChI | InChI=1S/C31H27F4N5O5/c1-30(2,29-37-15-44-40-29)39-26(41)20-13-17(7-10-23(20)43-4)19-14-21-24(27(42)36-3)25(16-5-8-18(32)9-6-16)45-28(21)38-22(19)11-12-31(33,34)35/h5-10,13-15H,11-12H2,1-4H3,(H,36,42)(H,39,41) |
| InChIKey | UQRNHYJTCGLJHY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |