C20H26Cl3N5O — CID 85473286
4-(3-methoxyphenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 85473286) has the molecular formula C20H26Cl3N5O and a molecular weight of 458.82 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-methoxyphenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 85473286 |
| Molecular Formula | C20H26Cl3N5O |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cccc(-c2nc(NCC3CCN(C(C)C)CC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C20H26Cl3N5O/c1-13(2)28-9-7-14(8-10-28)12-24-19-26-17(25-18(27-19)20(21,22)23)15-5-4-6-16(11-15)29-3/h4-6,11,13-14H,7-10,12H2,1-3H3,(H,24,25,26,27) |
| InChIKey | IKNYWVKDASWSSI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|