C17H20Cl3N5O2 — CID 85473289
2-(3,5-dimethoxyphenyl)-4-(4-methylpiperazin-1-yl)-6-(trichloromethyl)-1,3,5-triazine (PubChem CID 85473289) has the molecular formula C17H20Cl3N5O2 and a molecular weight of 432.74 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-(4-methylpiperazin-1-yl)-6-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-(4-methylpiperazin-1-yl)-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 85473289 |
| Molecular Formula | C17H20Cl3N5O2 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-(4-methylpiperazin-1-yl)-6-(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1cc(OC)cc(-c2nc(N3CCN(C)CC3)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C17H20Cl3N5O2/c1-24-4-6-25(7-5-24)16-22-14(21-15(23-16)17(18,19)20)11-8-12(26-2)10-13(9-11)27-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | VWIUFQAFLWPUDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|