C16H20Cl3N5O2 — CID 85473290
1-N-[4-(3,5-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine (PubChem CID 85473290) has the molecular formula C16H20Cl3N5O2 and a molecular weight of 420.73 g/mol. Its IUPAC name is 1-N-[4-(3,5-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[4-(3,5-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 85473290 |
| Molecular Formula | C16H20Cl3N5O2 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-N-[4-(3,5-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-2-methylpropane-1,2-diamine |
| SMILES | COc1cc(OC)cc(-c2nc(NCC(C)(C)N)nc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C16H20Cl3N5O2/c1-15(2,20)8-21-14-23-12(22-13(24-14)16(17,18)19)9-5-10(25-3)7-11(6-9)26-4/h5-7H,8,20H2,1-4H3,(H,21,22,23,24) |
| InChIKey | FMKNSRVCEPMIFP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|