C30H24F4N6O4 — CID 85473349
2-(4-fluorophenyl)-N-methyl-5-[3-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropyl]carbamoyl]phenyl]-6-(2,2,2-trifluoroethylamino)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 85473349) has the molecular formula C30H24F4N6O4 and a molecular weight of 608.55 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-5-[3-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropyl]carbamoyl]phenyl]-6-(2,2,2-trifluoroethylamino)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-5-[3-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropyl]carbamoyl]phenyl]-6-(2,2,2-trifluoroethylamino)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 85473349 |
| Molecular Formula | C30H24F4N6O4 |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-5-[3-[[1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropyl]carbamoyl]phenyl]-6-(2,2,2-trifluoroethylamino)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(NCC(F)(F)F)c(-c3cccc(C(=O)NC4(c5nc(C)no5)CC4)c3)cc12 |
| InChI | InChI=1S/C30H24F4N6O4/c1-15-37-28(44-40-15)29(10-11-29)39-25(41)18-5-3-4-17(12-18)20-13-21-22(26(42)35-2)23(16-6-8-19(31)9-7-16)43-27(21)38-24(20)36-14-30(32,33)34/h3-9,12-13H,10-11,14H2,1-2H3,(H,35,42)(H,36,38)(H,39,41) |
| InChIKey | IAJDHQMVDOYTBK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |