About 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide
2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide (PubChem CID 85477526) has the molecular formula C18H16Cl3N3O2
and a molecular weight of 412.70 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide |
| PubChem CID | 85477526 |
| Molecular Formula | C18H16Cl3N3O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=C(CN1CNC(c2ccc(Cl)cc2)CC1=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O2/c19-12-3-1-11(2-4-12)15-8-18(26)24(10-22-15)9-17(25)23-16-7-13(20)5-6-14(16)21/h1-7,15,22H,8-10H2,(H,23,25) |
| InChIKey | VMHSBRHYMCIHMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide?
The IUPAC name of 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide (CID 85477526) is 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide?
The canonical SMILES for 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide is O=C(CN1CNC(c2ccc(Cl)cc2)CC1=O)Nc1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide?
The InChIKey is VMHSBRHYMCIHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl3N3O2/c19-12-3-1-11(2-4-12)15-8-18(26)24(10-22-15)9-17(25)23-16-7-13(20)5-6-14(16)21/h1-7,15,22H,8-10H2,(H,23,25).
What are the key properties of 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide?
2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide has a molecular weight of 412.70 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-6-oxo-1,3-diazinan-1-yl]-N-(2,5-dichlorophenyl)acetamide is sourced from PubChem (CID 85477526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).