About 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one
7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 854973) has the molecular formula C13H10N2OS
and a molecular weight of 242.30 g/mol. Its IUPAC name is 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
Molecular Properties
| Compound Name | 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| PubChem CID | 854973 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | CC1=NC2=S=C(c3ccccc3)C(=O)N2C=C1 |
| InChI | InChI=1S/C13H10N2OS/c1-9-7-8-15-12(16)11(17-13(15)14-9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | XDGGELZYTVWQKC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one?
The IUPAC name of 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one (CID 854973) is 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
What is the SMILES notation for 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one?
The canonical SMILES for 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one is CC1=NC2=S=C(c3ccccc3)C(=O)N2C=C1.
What is the InChIKey of 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one?
The InChIKey is XDGGELZYTVWQKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2OS/c1-9-7-8-15-12(16)11(17-13(15)14-9)10-5-3-2-4-6-10/h2-8H,1H3.
What are the key properties of 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one?
7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one has a molecular weight of 242.30 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-3-one is sourced from PubChem (CID 854973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).