C18H21N3O3 — CID 85498679
3,5-dimethoxy-N-(5-phenylpyrazolidin-3-yl)benzamide (PubChem CID 85498679) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(5-phenylpyrazolidin-3-yl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(5-phenylpyrazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 85498679 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3,5-dimethoxy-N-(5-phenylpyrazolidin-3-yl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC2CC(c3ccccc3)NN2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-23-14-8-13(9-15(10-14)24-2)18(22)19-17-11-16(20-21-17)12-6-4-3-5-7-12/h3-10,16-17,20-21H,11H2,1-2H3,(H,19,22) |
| InChIKey | FLWIDTJCKSFXGF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |