About 2-hydroxypropanal
2-hydroxypropanal (PubChem CID 855) has the molecular formula C3H6O2
and a molecular weight of 74.08 g/mol. Its IUPAC name is 2-hydroxypropanal.
Molecular Properties
| Compound Name | 2-hydroxypropanal |
| PubChem CID | 855 |
| Molecular Formula | C3H6O2 |
| Molecular Weight | 74.08 g/mol |
| Exact Mass | 74.04 |
| IUPAC Name | 2-hydroxypropanal |
| SMILES | CC(O)C=O |
| InChI | InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3 |
| InChIKey | BSABBBMNWQWLLU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.08 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanal?
The IUPAC name of 2-hydroxypropanal (CID 855) is 2-hydroxypropanal.
What is the SMILES notation for 2-hydroxypropanal?
The canonical SMILES for 2-hydroxypropanal is CC(O)C=O.
What is the InChIKey of 2-hydroxypropanal?
The InChIKey is BSABBBMNWQWLLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3.
What are the key properties of 2-hydroxypropanal?
2-hydroxypropanal has a molecular weight of 74.08 g/mol, XLogP of -0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanal is sourced from PubChem (CID 855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).