About 3-benzyl-1,1-dimethylthiourea
3-benzyl-1,1-dimethylthiourea (PubChem CID 855080) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-benzyl-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-benzyl-1,1-dimethylthiourea |
| PubChem CID | 855080 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-benzyl-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C10H14N2S/c1-12(2)10(13)11-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,11,13) |
| InChIKey | XZGRYNLIECOIAV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,1-dimethylthiourea?
The IUPAC name of 3-benzyl-1,1-dimethylthiourea (CID 855080) is 3-benzyl-1,1-dimethylthiourea.
What is the SMILES notation for 3-benzyl-1,1-dimethylthiourea?
The canonical SMILES for 3-benzyl-1,1-dimethylthiourea is CN(C)C(=S)NCc1ccccc1.
What is the InChIKey of 3-benzyl-1,1-dimethylthiourea?
The InChIKey is XZGRYNLIECOIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-12(2)10(13)11-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,11,13).
What are the key properties of 3-benzyl-1,1-dimethylthiourea?
3-benzyl-1,1-dimethylthiourea has a molecular weight of 194.30 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,1-dimethylthiourea is sourced from PubChem (CID 855080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).