C18H24F3N3O4 — CID 8550979
methyl (2S,3R)-3-methyl-2-[[2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetyl]amino]pentanoate (PubChem CID 8550979) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is methyl (2S,3R)-3-methyl-2-[[2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetyl]amino]pentanoate.
| Compound Name | methyl (2S,3R)-3-methyl-2-[[2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 8550979 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methyl (2S,3R)-3-methyl-2-[[2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]acetyl]amino]pentanoate |
| SMILES | CC[C@@H](C)C(NC(=O)CN(C)CC(=O)Nc1ccc(F)c(F)c1F)C(=O)OC |
| InChI | InChI=1S/C18H24F3N3O4/c1-5-10(2)17(18(27)28-4)23-14(26)9-24(3)8-13(25)22-12-7-6-11(19)15(20)16(12)21/h6-7,10,17H,5,8-9H2,1-4H3,(H,22,25)(H,23,26)/t10-,17?/m1/s1 |
| InChIKey | VHLHIJWKXPVCRM-YQDUUYOCSA-N |
| XLogP | 1.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|