C20H26N3O4+ — CID 8551397
[2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(4,5-dimethoxy-2-methylphenyl)methyl]-methylazanium (PubChem CID 8551397) has the molecular formula C20H26N3O4+ and a molecular weight of 372.45 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(4,5-dimethoxy-2-methylphenyl)methyl]-methylazanium.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(4,5-dimethoxy-2-methylphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8551397 |
| Molecular Formula | C20H26N3O4+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(4,5-dimethoxy-2-methylphenyl)methyl]-methylazanium |
| SMILES | COc1cc(C)c(C[NH+](C)CC(=O)NNC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H25N3O4/c1-14-10-17(26-3)18(27-4)11-16(14)12-23(2)13-19(24)21-22-20(25)15-8-6-5-7-9-15/h5-11H,12-13H2,1-4H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | QCVQSWVDBZGIBJ-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|