C21H25NO4S — CID 8551432
[2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(4-methoxyphenyl)sulfanylacetate (PubChem CID 8551432) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(4-methoxyphenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8551432 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(4-methoxyphenyl)sulfanylacetate |
| SMILES | CCC[C@H](NC(=O)COC(=O)CSc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO4S/c1-3-7-19(16-8-5-4-6-9-16)22-20(23)14-26-21(24)15-27-18-12-10-17(25-2)11-13-18/h4-6,8-13,19H,3,7,14-15H2,1-2H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | RFGGKQCJMZIECZ-IBGZPJMESA-N |
| XLogP | 3.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |