C16H18ClNOS2 — CID 8552521
(2R)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 8552521) has the molecular formula C16H18ClNOS2 and a molecular weight of 339.91 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 8552521 |
| Molecular Formula | C16H18ClNOS2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methylsulfanyl]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | C[C@@H](SCc1ccc(Cl)cc1)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C16H18ClNOS2/c1-12(21-11-13-4-6-14(17)7-5-13)16(19)18-9-8-15-3-2-10-20-15/h2-7,10,12H,8-9,11H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | LRBZGKKJARVKAS-GFCCVEGCSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |