C18H23N4O3+ — CID 8554639
5-methoxy-2-(2-methylphenyl)-6-(4-methylpiperazin-4-ium-1-carbonyl)pyridazin-3-one (PubChem CID 8554639) has the molecular formula C18H23N4O3+ and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-methoxy-2-(2-methylphenyl)-6-(4-methylpiperazin-4-ium-1-carbonyl)pyridazin-3-one.
| Compound Name | 5-methoxy-2-(2-methylphenyl)-6-(4-methylpiperazin-4-ium-1-carbonyl)pyridazin-3-one |
|---|---|
| PubChem CID | 8554639 |
| Molecular Formula | C18H23N4O3+ |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 5-methoxy-2-(2-methylphenyl)-6-(4-methylpiperazin-4-ium-1-carbonyl)pyridazin-3-one |
| SMILES | COc1cc(=O)n(-c2ccccc2C)nc1C(=O)N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C18H22N4O3/c1-13-6-4-5-7-14(13)22-16(23)12-15(25-3)17(19-22)18(24)21-10-8-20(2)9-11-21/h4-7,12H,8-11H2,1-3H3/p+1 |
| InChIKey | ZTSASTIZWPNVKV-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |