C16H21N5O2S — CID 855581
4-methyl-N'-[2-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 855581) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-methyl-N'-[2-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-methyl-N'-[2-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 855581 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-methyl-N'-[2-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CSc2nnc(C(C)C)n2C)cc1 |
| InChI | InChI=1S/C16H21N5O2S/c1-10(2)14-18-20-16(21(14)4)24-9-13(22)17-19-15(23)12-7-5-11(3)6-8-12/h5-8,10H,9H2,1-4H3,(H,17,22)(H,19,23) |
| InChIKey | QOSKLKVDLKXUHF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|