C22H28N2O4S — CID 8556430
[2-(4-tert-butylanilino)-2-oxoethyl] (2S)-3-methyl-2-(thiophene-2-carbonylamino)butanoate (PubChem CID 8556430) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] (2S)-3-methyl-2-(thiophene-2-carbonylamino)butanoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] (2S)-3-methyl-2-(thiophene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 8556430 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] (2S)-3-methyl-2-(thiophene-2-carbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)c1cccs1)C(=O)OCC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O4S/c1-14(2)19(24-20(26)17-7-6-12-29-17)21(27)28-13-18(25)23-16-10-8-15(9-11-16)22(3,4)5/h6-12,14,19H,13H2,1-5H3,(H,23,25)(H,24,26)/t19-/m0/s1 |
| InChIKey | XDHRHRUOIYFFBA-IBGZPJMESA-N |
| XLogP | 3.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |