About 2,6-diaminoanthracene-9,10-dione
2,6-diaminoanthracene-9,10-dione (PubChem CID 8557) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2,6-diaminoanthracene-9,10-dione.
Molecular Properties
| Compound Name | 2,6-diaminoanthracene-9,10-dione |
| PubChem CID | 8557 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2,6-diaminoanthracene-9,10-dione |
| SMILES | Nc1ccc2c(c1)C(=O)c1ccc(N)cc1C2=O |
| InChI | InChI=1S/C14H10N2O2/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6H,15-16H2 |
| InChIKey | WQOWBWVMZPPPGX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diaminoanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diaminoanthracene-9,10-dione?
The IUPAC name of 2,6-diaminoanthracene-9,10-dione (CID 8557) is 2,6-diaminoanthracene-9,10-dione.
What is the SMILES notation for 2,6-diaminoanthracene-9,10-dione?
The canonical SMILES for 2,6-diaminoanthracene-9,10-dione is Nc1ccc2c(c1)C(=O)c1ccc(N)cc1C2=O.
What is the InChIKey of 2,6-diaminoanthracene-9,10-dione?
The InChIKey is WQOWBWVMZPPPGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6H,15-16H2.
What are the key properties of 2,6-diaminoanthracene-9,10-dione?
2,6-diaminoanthracene-9,10-dione has a molecular weight of 238.25 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diaminoanthracene-9,10-dione is sourced from PubChem (CID 8557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).