About N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide
N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide (PubChem CID 8557810) has the molecular formula C13H25N2O3S+
and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
| PubChem CID | 8557810 |
| Molecular Formula | C13H25N2O3S+ |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
| SMILES | CC1CC[NH+](CC(=O)N[C@@]2(C)CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H24N2O3S/c1-11-3-6-15(7-4-11)9-12(16)14-13(2)5-8-19(17,18)10-13/h11H,3-10H2,1-2H3,(H,14,16)/p+1/t13-/m0/s1 |
| InChIKey | PSKMFUQCYAJAFM-ZDUSSCGKSA-O |
| XLogP | -1.01 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide?
The IUPAC name of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide (CID 8557810) is N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide.
What is the SMILES notation for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide?
The canonical SMILES for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide is CC1CC[NH+](CC(=O)N[C@@]2(C)CCS(=O)(=O)C2)CC1.
What is the InChIKey of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide?
The InChIKey is PSKMFUQCYAJAFM-ZDUSSCGKSA-O. The full InChI is InChI=1S/C13H24N2O3S/c1-11-3-6-15(7-4-11)9-12(16)14-13(2)5-8-19(17,18)10-13/h11H,3-10H2,1-2H3,(H,14,16)/p+1/t13-/m0/s1.
What are the key properties of N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide?
N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide has a molecular weight of 289.42 g/mol, XLogP of -1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-2-(4-methylpiperidin-1-ium-1-yl)acetamide is sourced from PubChem (CID 8557810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).