C13H18BrN3O3 — CID 8558737
2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-N-(methylcarbamoyl)acetamide (PubChem CID 8558737) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8558737 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methyl-methylamino]-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CN(C)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H18BrN3O3/c1-15-13(19)16-12(18)8-17(2)7-9-6-10(14)4-5-11(9)20-3/h4-6H,7-8H2,1-3H3,(H2,15,16,18,19) |
| InChIKey | ZRLMONWDALHHAT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |