About 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol
4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol (PubChem CID 855989) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol |
| PubChem CID | 855989 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2nnc(SCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H12N2O2S/c18-13-8-6-12(7-9-13)14-16-17-15(19-14)20-10-11-4-2-1-3-5-11/h1-9,18H,10H2 |
| InChIKey | KLMFEJLVDLLWJA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol?
The IUPAC name of 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol (CID 855989) is 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol.
What is the SMILES notation for 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol?
The canonical SMILES for 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol is Oc1ccc(-c2nnc(SCc3ccccc3)o2)cc1.
What is the InChIKey of 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol?
The InChIKey is KLMFEJLVDLLWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c18-13-8-6-12(7-9-13)14-16-17-15(19-14)20-10-11-4-2-1-3-5-11/h1-9,18H,10H2.
What are the key properties of 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol?
4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol has a molecular weight of 284.34 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)phenol is sourced from PubChem (CID 855989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).