About 1-pyren-1-yltetrazole
1-pyren-1-yltetrazole (PubChem CID 856007) has the molecular formula C17H10N4
and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-pyren-1-yltetrazole.
Molecular Properties
| Compound Name | 1-pyren-1-yltetrazole |
| PubChem CID | 856007 |
| Molecular Formula | C17H10N4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-pyren-1-yltetrazole |
| SMILES | c1cc2ccc3ccc(-n4cnnn4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C17H10N4/c1-2-11-4-5-13-7-9-15(21-10-18-19-20-21)14-8-6-12(3-1)16(11)17(13)14/h1-10H |
| InChIKey | YREQSECNSOIWKW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-pyren-1-yltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyren-1-yltetrazole?
The IUPAC name of 1-pyren-1-yltetrazole (CID 856007) is 1-pyren-1-yltetrazole.
What is the SMILES notation for 1-pyren-1-yltetrazole?
The canonical SMILES for 1-pyren-1-yltetrazole is c1cc2ccc3ccc(-n4cnnn4)c4ccc(c1)c2c34.
What is the InChIKey of 1-pyren-1-yltetrazole?
The InChIKey is YREQSECNSOIWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4/c1-2-11-4-5-13-7-9-15(21-10-18-19-20-21)14-8-6-12(3-1)16(11)17(13)14/h1-10H.
What are the key properties of 1-pyren-1-yltetrazole?
1-pyren-1-yltetrazole has a molecular weight of 270.30 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyren-1-yltetrazole is sourced from PubChem (CID 856007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).