About [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate
[3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate (PubChem CID 856200) has the molecular formula C14H9ClN4O2
and a molecular weight of 300.71 g/mol. Its IUPAC name is [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate |
| PubChem CID | 856200 |
| Molecular Formula | C14H9ClN4O2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate |
| SMILES | O=C(Oc1cccc(-n2cnnn2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H9ClN4O2/c15-11-4-1-3-10(7-11)14(20)21-13-6-2-5-12(8-13)19-9-16-17-18-19/h1-9H |
| InChIKey | OCSUVPAWBIOUPM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate?
The IUPAC name of [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate (CID 856200) is [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate.
What is the SMILES notation for [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate?
The canonical SMILES for [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate is O=C(Oc1cccc(-n2cnnn2)c1)c1cccc(Cl)c1.
What is the InChIKey of [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate?
The InChIKey is OCSUVPAWBIOUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN4O2/c15-11-4-1-3-10(7-11)14(20)21-13-6-2-5-12(8-13)19-9-16-17-18-19/h1-9H.
What are the key properties of [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate?
[3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate has a molecular weight of 300.71 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(tetrazol-1-yl)phenyl] 3-chlorobenzoate is sourced from PubChem (CID 856200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).