C17H27N3O3S — CID 8562569
(4S)-N-[3-(dimethylamino)propyl]-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 8562569) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is (4S)-N-[3-(dimethylamino)propyl]-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (4S)-N-[3-(dimethylamino)propyl]-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 8562569 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (4S)-N-[3-(dimethylamino)propyl]-4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1ccc(OC)c2c1CN(C(=S)NCCCN(C)C)C[C@H]2O |
| InChI | InChI=1S/C17H27N3O3S/c1-19(2)9-5-8-18-17(24)20-10-12-14(22-3)6-7-15(23-4)16(12)13(21)11-20/h6-7,13,21H,5,8-11H2,1-4H3,(H,18,24)/t13-/m1/s1 |
| InChIKey | WRCFABGJXHHGKA-CYBMUJFWSA-N |
| XLogP | 1.38 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|