C21H21N3O4S — CID 8563300
N-(3,4-dimethylphenyl)-N-[4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 8563300) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-[4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-N-[4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8563300 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-[4-[(4-methyl-2-nitrophenoxy)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1ccc(C)c(C)c1)c1nc(COc2ccc(C)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C21H21N3O4S/c1-13-5-8-20(19(9-13)24(26)27)28-11-17-12-29-21(22-17)23(16(4)25)18-7-6-14(2)15(3)10-18/h5-10,12H,11H2,1-4H3 |
| InChIKey | VMCYYTZOYGMBSA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|