C11H12N4O2S — CID 8564349
methyl 3-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzoate (PubChem CID 8564349) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is methyl 3-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8564349 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 3-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(CSc2nnnn2C)c1 |
| InChI | InChI=1S/C11H12N4O2S/c1-15-11(12-13-14-15)18-7-8-4-3-5-9(6-8)10(16)17-2/h3-6H,7H2,1-2H3 |
| InChIKey | HGQHCIRJTCZBLA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |