C18H25N7O2S — CID 8565061
N-(2-ethylphenyl)-2-[4-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperazin-1-yl]acetamide (PubChem CID 8565061) has the molecular formula C18H25N7O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8565061 |
| Molecular Formula | C18H25N7O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)CSc2nnnn2C)CC1 |
| InChI | InChI=1S/C18H25N7O2S/c1-3-14-6-4-5-7-15(14)19-16(26)12-24-8-10-25(11-9-24)17(27)13-28-18-20-21-22-23(18)2/h4-7H,3,8-13H2,1-2H3,(H,19,26) |
| InChIKey | ZFALUSBEMNBLMW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |