About N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide
N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide (PubChem CID 856583) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide |
| PubChem CID | 856583 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide |
| SMILES | Cc1cc2ncn(CCC(=O)NC(C)(C)C)c2cc1C |
| InChI | InChI=1S/C16H23N3O/c1-11-8-13-14(9-12(11)2)19(10-17-13)7-6-15(20)18-16(3,4)5/h8-10H,6-7H2,1-5H3,(H,18,20) |
| InChIKey | VHJUVJZGDOREBR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide?
The IUPAC name of N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide (CID 856583) is N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide.
What is the SMILES notation for N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide?
The canonical SMILES for N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide is Cc1cc2ncn(CCC(=O)NC(C)(C)C)c2cc1C.
What is the InChIKey of N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide?
The InChIKey is VHJUVJZGDOREBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-11-8-13-14(9-12(11)2)19(10-17-13)7-6-15(20)18-16(3,4)5/h8-10H,6-7H2,1-5H3,(H,18,20).
What are the key properties of N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide?
N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide has a molecular weight of 273.38 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-(5,6-dimethylbenzimidazol-1-yl)propanamide is sourced from PubChem (CID 856583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).